Aldehydes, Ketones, and Carboxylic Acids - Class 12

The Kiliani-Fischer synthesis of D-glucose using an aqueous \ce{NaCN}/\ce{HCN} buffer (pH $\approx$ 8.5) yields two epimeric heptonic acids, $X$ (major) and $Y$ (minor), after hydrolysis. Under these pH-controlled conditions, the stereochemical outcome deviates from simple kinetic addition. Which of the following statements correctly identifies the major product $X$ and the governing stereochemical rationale?

L-Lysine is an essential amino acid with macroscopic $pK_a$ values of $2.18$ ($\alpha$-\ce{COOH}), $8.95$ ($\alpha$-\ce{NH3+}), and $10.53$ ($\epsilon$-\ce{NH3+}). It undergoes nucleophilic addition with one equivalent of benzaldehyde to form a Schiff base. The regioselectivity of this reaction is highly pH-dependent.

Let $R$ be the ratio of the concentration of the microstate with a free $\alpha$-amine and protonated $\epsilon$-amine to the microstate with a protonated $\alpha$-amine and free $\epsilon$-amine in an aqueous solution.

Calculate $R$. Furthermore, identify the major Schiff base product formed when the reaction is conducted at $pH = 11.50$ under kinetic control.

(Assume the intrinsic nucleophilicity of the unhindered $\epsilon$-amine is greater than the $\alpha$-amine. Given: $10^{1.58} \approx 38$)

Compound \textbf{X}, methyl 4-acetylbenzoate, is reacted with one equivalent of aniline ($\ce{PhNH2}$) under three distinct sets of conditions to yield the major organic equilibrium products \textbf{P}, \textbf{Q}, and \textbf{R} respectively (excluding aniline derivatives if unreacted or protonated):

\begin{itemize} \item \textbf{Condition I:} Anhydrous $\ce{MgSO4}$, catalytic $\ce{CH3COOH}$ (pH $\approx$ 4.5), 298 K $\rightarrow$ \textbf{P} \item \textbf{Condition II:} Excess $\ce{H2O}$, dilute aqueous $\ce{HCl}$ (pH = 1.0), 373 K $\rightarrow$ \textbf{Q} \item \textbf{Condition III:} Excess $\ce{H2O}$, aqueous acetate buffer (pH = 4.5), 298 K $\rightarrow$ \textbf{R} \end{itemize}

Identify \textbf{P}, \textbf{Q}, and \textbf{R}.

Consider the formation of Schiff bases from benzaldehyde with two different aromatic amines at $298\text{ K}$ in an aqueous ethanolic buffer:

Reaction I: $\ce{Ph-CHO} + \ce{Ph-NH2} \rightleftharpoons \text{Imine 1} + \ce{H2O}$ Reaction II: $\ce{Ph-CHO} + \ce{2,6-(CH3)2C6H3NH2} \rightleftharpoons \text{Imine 2} + \ce{H2O}$

For Reaction I, the optimal pH is approximately $4.5$, and the rate-determining step (RDS) is typically the acid-catalyzed dehydration of the hemiaminal intermediate. Due to the 'Ortho-Effect' and steric constraints in Reaction II, how do the optimal pH profile and the RDS change compared to Reaction I?

An acyclic compound $\textbf{X}$ is 4-(benzylamino)butanal. It is subjected to two different reaction conditions: \begin{itemize} \item \textbf{Reaction 1:} $\textbf{X}$ is treated with 1 equivalent of \ce{NaCN} in an aqueous buffer at pH = 9.5 at 298 K. The major product isolated is $\textbf{P}$. \item \textbf{Reaction 2:} $\textbf{X}$ is treated with 1 equivalent of \ce{NaCN} in an aqueous buffer at pH = 4.5 at 298 K. The major product isolated is $\textbf{Q}$. \end{itemize} Identify the major products $\textbf{P}$ and $\textbf{Q}$.

Compound \textbf{X}, tert-butyl 2-formylbenzoate, is subjected to the following two-step reaction sequence: $\textbf{X} \xrightarrow[2. \text{ Cold aqueous buffer (pH = 7)}]{1. \ce{NaBH4} \text{ (1.0 equiv), } \ce{EtOH}, 298\text{ K}} \textbf{Y}$ $\textbf{Y} \xrightarrow{\ce{CF3COOH}, \ce{CH2Cl2}, 298\text{ K}} \textbf{Z}$ Identify the major products \textbf{Y} and \textbf{Z}.

An organic compound $\mathbf{X}$ ($\ce{C11H12O2}$) is identified as 2,2-dimethyl-3-oxo-3-phenylpropanal.

Reaction I: $\mathbf{X}$ is treated with an excess of $\ce{LiAlH4}$ in anhydrous ether, followed by mild acidic workup, to yield the major product $\mathbf{Y}$.

Reaction II: $\mathbf{X}$ is heated with concentrated aqueous $\ce{NaOH}$, followed by acidic workup, to yield a major organic product $\mathbf{Z}$ containing a benzene ring, along with a one-carbon byproduct.

Identify $\mathbf{Y}$ and $\mathbf{Z}$.

An aldopentose, D-lyxose, is subjected to Kiliani-Fischer chain extension to yield a mixture of two epimeric aldonolactones. One of these lactones, $Y$, is isolated based on the property that its exhaustive reduction yields an optically inactive alditol. Lactone $Y$ is then subjected to two distinct reduction protocols:

\textbf{Protocol I:} Treatment with 1 equivalent of DIBAL-H in toluene at $-78^\circ\text{C}$, followed by mild aqueous acidic workup, yielding compound $P$.

\textbf{Protocol II:} Treatment with excess $\ce{NaBH4}$ in aqueous ethanol at $298\text{ K}$, yielding compound $Q$.

Which of the following statements correctly describes the properties of $P$ and $Q$?

Consider the chiral amino ketone, (2S)-2-(dimethylamino)-1-phenylpropan-1-one (Compound \textbf{X}). Compound \textbf{X} is subjected to two different reduction pathways:

\textbf{Pathway 1:} Reduction with \ce{LiAlH4} in dry diethyl ether at $-78^\circ\text{C}$ to yield major product \textbf{P}.

\textbf{Pathway 2:} Compound \textbf{X} is treated with 1 equivalent of anhydrous \ce{HCl} in ether to form a salt, followed by reduction with \ce{NaBH4} in ethanol to yield major product \textbf{Q}.

Assuming standard stereochemical models, identify the absolute configurations of the newly formed chiral center (C1) and the existing chiral center (C2) in the major products \textbf{P} and \textbf{Q} respectively.

Consider the compound \textbf{X}, 1-(4-hydroxyphenyl)pent-4-en-1-one. \textbf{X} is subjected to two different reduction conditions to yield major products \textbf{P} and \textbf{Q}:

Reaction 1: \textbf{X} $\xrightarrow{\ce{Zn(Hg), conc. HCl, \Delta}}$ \textbf{P}

Reaction 2: \textbf{X} $\xrightarrow{\ce{NH2NH2, KOH, ethylene glycol, \Delta}}$ \textbf{Q}

Identify the major products \textbf{P} and \textbf{Q}.

Consider the reaction of 1-(benzyloxy)propan-2-one under standard Clemmensen reduction conditions:

$\text{1-(benzyloxy)propan-2-one} \xrightarrow[\Delta]{\text{Zn(Hg), conc. HCl}} \text{Major Product(s)}$

Identify the major organic product(s) formed in this reaction.

Consider the organic compound $\textbf{X}$, $N$-(4-acetylphenyl)methanesulfonamide. The objective is to chemoselectively reduce the carbonyl group to synthesize $N$-(4-ethylphenyl)methanesulfonamide ($\textbf{Y}$). Which of the following reagent systems is the most appropriate to achieve this transformation in high yield without degrading the sulfonamide functional group?

Consider the organic compound $\textbf{X}$: 2-(4-acetyl-2-nitrophenyl)-1,3-dioxolane. It is subjected to two different reduction protocols to yield the major products $\textbf{Y}$ and $\textbf{Z}$:

Reaction I: $\textbf{X} \xrightarrow{Zn(Hg), \text{ conc. } HCl, \Delta} \textbf{Y}$

Reaction II: $\textbf{X} \xrightarrow{NH_2NH_2, KOH, \text{ ethylene glycol, } \Delta} \textbf{Z}$

Identify the major products $\textbf{Y}$ and $\textbf{Z}$.

Consider the diketone $\textbf{X}$, 2,2,4,4-tetramethylnonane-3,8-dione. $\textbf{X}$ is subjected to the following two-step reaction sequence:

Step 1: Excess $\ce{NH2NH2}$, $\ce{KOH}$, ethylene glycol, $473\ K \rightarrow \textbf{Y}$ (Major Product) Step 2: $\ce{LiAlH4}$ in dry ether, followed by aqueous acid workup $\rightarrow \textbf{Z}$ (Major Product)

Identify the IUPAC name of the final product $\textbf{Z}$.

An organic compound $\textbf{X}$, 4-hydroxy-5,5-dimethylhexan-2-one ($\ce{CH3-C(=O)-CH2-CH(OH)-C(CH3)3}$), is treated with amalgamated zinc and concentrated hydrochloric acid under heating. Assuming the reaction is thermodynamically controlled with respect to the carbon skeleton, identify the major organic product formed.

Consider the intramolecular Aldol condensation of 7,7-dimethyl-6-oxooctanal in the presence of dilute aqueous $\ce{NaOH}$ at $353\text{ K}$. Identify the major organic product formed.

Octane-2,7-dione undergoes an intramolecular aldol condensation in the presence of aqueous \ce{NaOH} upon heating to yield compound $\mathbf{P}$ as the major product. $\mathbf{P}$ is subjected to dihydroxylation using catalytic \ce{OsO4} and NMO to form a cis-diol $\mathbf{Q}$. Reaction of $\mathbf{Q}$ with acetone in the presence of catalytic $p$-toluenesulfonic acid yields compound $\mathbf{R}$. Finally, $\mathbf{R}$ is treated with reagent $\mathbf{X}$ to produce compound $\mathbf{S}$ (3a-ethyl-2,2,6a-trimethyl-tetrahydro-4H-cyclopenta[d][1,3]dioxole) as the major product.

Which of the following correctly identifies the IUPAC name of $\mathbf{R}$ and the appropriate reagent $\mathbf{X}$?

An equimolar mixture of \ce{tert-butyl 5,5-dimethyl-4-oxohexanoate} and benzaldehyde is treated with an excess of aqueous \ce{NaOH} at $350\text{ K}$ for an extended period. The reaction mixture is then subjected to careful acidic workup. Which of the following is the major aliphatic product isolated?

Consider the following reaction sequence:

$\ce{CH3-CO-CH3} \xrightarrow[\text{THF, } -78^\circ\text{C}]{\text{LDA (1 eq.)}} \text{X}$

$\text{X} \xrightarrow[\text{2. } \ce{H3O^+}]{\text{1. } \ce{(CH3)3C-CHO}} \text{P}$

$\text{P} \xrightarrow[\text{2. } \ce{H3O^+}]{\text{1. } \ce{LiAlH4}, \text{ dry ether}} \text{Q}$

$\text{Q} \xrightarrow[\text{298 K}]{\ce{HIO4} \text{ (aq)}} \text{R}$

Identify the structure of the final major product R.

An equimolar mixture of 2-aminobenzaldehyde and ethyl 3-oxobutanoate is refluxed in the presence of catalytic aqueous $\ce{NaOH}$ at $353\ \text{K}$. Considering competing nucleophilic pathways and thermodynamic stability, identify the major organic product $P$.

An organic compound \textbf{X} ($\ce{C10H10O2}$) gives a positive Tollens' test and a positive iodoform test. A student attempts to perform a Cannizzaro reaction on \textbf{X} by treating it with 50% aqueous $\ce{NaOH}$ at $100^\circ\text{C}$, assuming the aldehyde group lacks $\alpha$-hydrogens. However, the reaction yields a single major aromatic product \textbf{Y} ($\ce{C10H8O}$) instead of the expected disproportionation products. Which of the following represents the correct structure of \textbf{Y}?

Compound $\mathbf{X}$ is $4$-(methyl $\beta$-D-glucopyranosyloxy)benzaldehyde. It is reacted with excess $\ce{HCHO}$ in the presence of $50\% \text{ NaOH (aq)}$ at $363\text{ K}$. The reaction mixture is then carefully neutralized to $\text{pH } 7$, and the major aromatic product $\mathbf{Y}$ is isolated. Finally, $\mathbf{Y}$ is treated with Tollens' reagent ($\ce{[Ag(NH3)2]+}$ in aqueous ammonia). Which of the following correctly identifies the structure of $\mathbf{Y}$ and the observation for the Tollens' test?

Compound $\mathbf{X}$ is 2-(4-oxopentyl)benzaldehyde. It is heated with concentrated aqueous $\ce{KOH}$ at $353\text{ K}$ to yield a major organic product $\mathbf{Y}$. Subsequently, $\mathbf{Y}$ is treated with $\ce{I2}$ in excess aqueous $\ce{NaOH}$ at $298\text{ K}$, followed by careful acidification with dilute $\ce{HCl}$, to produce compound $\mathbf{Z}$. Identify the structure of $\mathbf{Z}$.

Consider the following substituted benzaldehydes subjected to Cannizzaro reaction conditions using $50\% \ \ce{NaOH_{(aq)}}$ at $298\ \text{K}$: (I) 4-Nitrobenzaldehyde (II) 3-Nitrobenzaldehyde (III) 2-Nitrobenzaldehyde (IV) 2,6-Dinitrobenzaldehyde

Which of the following represents the correct decreasing order of their initial reaction rates?

Trichloroacetaldehyde, \ce{CCl3CHO (aq)}, is a highly electrophilic carbonyl compound that forms a stable gem-diol hydrate ($K_{hyd} \gg 1$) in aqueous media. When 1.0 equivalent of \ce{CCl3CHO (aq)} is reacted with an excess of concentrated \ce{NaOD (aq)} in \ce{D2O (l)} at 298 K, the expected Cannizzaro reaction is completely suppressed due to a kinetically favored alternative pathway. A rapid fragmentation occurs, yielding a haloform derivative ($\mathbf{P}$) and a carboxylate salt ($\mathbf{Q}$). Identify the major organic products $\mathbf{P}$ and $\mathbf{Q}$.

Consider the following three reaction sequences performed on 2-methylcyclohexan-1-one:

\textbf{Sequence I:}

1. \ce{LDA} (1.1 equiv), \ce{THF}, $-78^\circ\text{C}$
2. Allyl bromide

\textbf{Sequence II:}

1. Pyrrolidine, cat. $p$-\ce{TsOH}, Benzene, $\Delta$ (Dean-Stark)
2. Allyl bromide
3. \ce{H3O+}

\textbf{Sequence III:}

1. \ce{TMSCl}, \ce{Et3N}, \ce{DMF}, $130^\circ\text{C}$
2. \ce{MeLi}, \ce{THF}, $0^\circ\text{C}$
3. Allyl bromide

Let the major organic products of Sequences I, II, and III be X, Y, and Z respectively. Identify X, Y, and Z.

Consider the reaction of 1,3,6-trimethylpyrimidine-2,4(1H,3H)-dione with 1.05 equivalents of Lithium diisopropylamide (LDA) in THF at $-78^\circ\text{C}$, followed by the addition of 1.1 equivalents of benzaldehyde. The reaction mixture is subsequently subjected to acidic workup and heated ($H_3O^+, \Delta$) to yield the major product $\textbf{P}$. Identify the structure of $\textbf{P}$.

Consider the reaction of 2-(trifluoromethyl)pentanedioic acid with one equivalent of \ce{Br2} in the presence of catalytic red phosphorus at 353 K, followed by aqueous workup. Which of the following represents the major organic product formed and the correct kinetic rationale for its regioselectivity?

Consider the optically active ester, ($S$)-2,4-dinitrophenyl 2-phenylpropanoate (Compound \textbf{X}). It is subjected to ammonolysis using isopropylamine ($iPrNH_2$) under two different solvent conditions at 298 K:

Reaction 1: \textbf{X} + excess $iPrNH_2$ in anhydrous $CH_3CN$ $\longrightarrow$ Product \textbf{P}

Reaction 2: \textbf{X} + excess $iPrNH_2$ in $H_2O$/EtOH mixture $\longrightarrow$ Product \textbf{Q}

Assuming no other side reactions, identify the stereochemical nature of the major amide products \textbf{P} and \textbf{Q}.

Consider the following reaction sequence: $\ce{2,4,6-Trimethylbenzoyl chloride ->[1. Excess CH3MgBr, Et2O, 298 K][2. H3O^+] P}$ $\ce{P ->[I2 (excess), NaOH (aq)][298 K] Q}$ Identify the major organic products P and Q.

Compound \textbf{X} (1-deoxy-D-fructose) is a carbohydrate derivative that possesses a \ce{CH3-C(=O)-} moiety in its acyclic form. However, when \textbf{X} is treated with excess \ce{I2} and \ce{NaOH} (aq) at 298 K, it fails to yield the characteristic yellow precipitate of iodoform (\ce{CHI3}). Which of the following statements best explains this anomalous chemical behavior?

Consider the organic compound $\textbf{P}$, 2-acetylbenzamide. $\textbf{P}$ is subjected to the following reaction sequence:

1. Excess $I_2$, $NaOH_{(aq)}$, $298\text{ K}$
2. $Na_2S_2O_3{(aq)}$, then dilute $HCl_{(aq)}$, $298\text{ K}$

Identify the major organic product $\textbf{Q}$.

Consider the acid dissociation of the glycine cation ($\ce{^+NH3-CH2-COOH}$, Acid I) and cyanoacetic acid ($\ce{NC-CH2-COOH}$, Acid II) at $298\ K$. Let $K_{a}(\text{I})$ and $K_{a}(\text{II})$ be their respective acid dissociation constants for the $\ce{-COOH}$ proton. Define the ratio of their dissociation constants as $R = \frac{K_{a}(\text{I})}{K_{a}(\text{II})}$. Let $R_W$ be the ratio in pure water (dielectric constant $\epsilon \approx 78$), where the $pK_a$ values are $2.34$ and $2.45$, respectively. Let $R_E$ be the ratio in an $80\%$ aqueous ethanol mixture ($\epsilon \approx 30$). Assuming no change in the primary structural conformations, which of the following mathematically represents the correct relationship between $R_W$ and $R_E$?

Consider two separate equimolar mixtures at 298 K: Mixture I: 2-Methylbenzoic acid and 4-Methylbenzoic acid. Mixture II: 2-Methylaniline and 4-Methylaniline.

Experiment 1: Mixture I is treated with 1.0 equivalent of aqueous \ce{NaOH}. The resulting solution is washed with ether, and the aqueous layer is subsequently acidified to yield predominantly compound $P$. Experiment 2: Mixture II is treated with 1.0 equivalent of benzenesulfonyl chloride (\ce{PhSO2Cl}) in the presence of excess pyridine. The major sulfonamide product formed is $Q$.

Identify $P$ and $Q$, along with the primary structural phenomenon governing their predominant formation.

Consider the following reaction sequence: $\ce{Phenol ->[\text{1. } CO_2, NaOH, 400 \text{ K, 4-7 atm}][\text{2. } H_3O^+] P ->[CH_3OH][H^+ \text{ (cat.)}] Q ->[NH_3 \text{ (aq)}] R ->[Br_2, KOH \text{ (aq)}][\Delta] S \text{ (Major Product)}}$ Identify the major organic product S.

Consider the following carboxylic acids: I. $\ce{CF3COOH}$ II. $\ce{CH3COCOOH}$ III. $\ce{CH3COCH2COOH}$ IV. $\ce{CCl3COOH}$

Which of the following options correctly identifies the decreasing order of their thermodynamic acidity ($K_a$) in aqueous solution at 298 K, and the decreasing order of their kinetic rate of thermal decarboxylation?

The acid-catalyzed Fischer esterification of acetic acid (\ce{CH3COOH}) with ethanol at 298 K has an equilibrium constant $K_c = 4.0$. A student attempts to synthesize ethyl trifluoroacetate by reacting 1.0 mol of trifluoroacetic acid (\ce{CF3COOH}) with 1.0 mol of ethanol in a 1.0 L flask at 298 K. The student erroneously assumes that the strong electron-withdrawing \ce{-CF3} group, which increases the acid's $K_a$ by a factor of $\approx 10^4$, will proportionally increase the esterification equilibrium constant, predicting a near quantitative yield. In reality, while the \ce{-CF3} group increases the electrophilicity of the carbonyl carbon, it also severely destabilizes the positively charged tetrahedral intermediate via inductive effects. Thermodynamically, the \ce{-CF3} group stabilizes the carboxylic acid more than the ester (due to differential resonance demands of the \ce{-OH} vs \ce{-OEt} groups), making the standard free energy of esterification for \ce{CF3COOH} less favorable by $\Delta(\Delta G^\circ) = RT \ln(16)$ compared to acetic acid. Assuming ideal behavior, calculate the actual equilibrium concentration of ethyl trifluoroacetate.

Consider the following reaction sequence for the enantiomerically pure compound \textbf{P}, which is (S)-2-carbamoyl-2-phenylpropanoic acid: \begin{enumerate} \item \ce{Br2} (1 equiv.), \ce{NaOH} (excess), $343\text{ K}$ \item Dil. \ce{HCl} (aq) added carefully until the pH of the solution is 5.5 \item The resulting aqueous solution is heated at $373\text{ K}$ for 2 hours \end{enumerate} Given that the isoelectric point (pI) of the resulting $\alpha$-amino acid is approximately 5.5, identify the major organic product isolated at the end of the sequence.

Silver 3-methyl-2-(trifluoromethyl)butanoate, $\ce{(CH_3)_2CH-CH(CF_3)-COOAg}$, is treated with $\ce{Br_2}$ in refluxing $\ce{CCl_4}$. Instead of the expected Hunsdiecker alkyl halide, the reaction yields a different major organic product. Identify the major product formed.

Which of the following reaction sequences is the most appropriate for the high-yield synthesis of 2-methyloxirane starting from propanoic acid?

Glycine ($\\ce{H2N-CH2-COOH}$) and Propanoic acid ($\\ce{CH3-CH2-COOH}$) are independently subjected to Fischer esterification using absolute ethanol and excess dry $\\ce{HCl}$ gas at $298\\text{ K}$. The rate of esterification of glycine is observed to be substantially lower than that of propanoic acid. Which of the following statements correctly explains this kinetic observation?

Consider the acid-catalyzed Fischer esterification of acetic acid ($\ce{CH3COOH}$) with ethanol ($\ce{C2H5OH}$) using anhydrous $\ce{HCl}$ gas as a catalyst at 298 K. The reaction kinetics are studied in two different solvent systems: System I (neat $\ce{C2H5OH}$, dielectric constant $\epsilon = 24.5$) and System II (cyclohexane, $\epsilon = 2.02$). The initial rate of esterification in System II is found to be negligible compared to System I. What is the primary mechanistic reason for this kinetic bottleneck in System II?

An equilibrium mixture of D-glucose in water at $298\text{ K}$ is lyophilized to yield a solid mixture of anomers. This solid is subjected to two distinct acetylation conditions:\n\nCondition 1: Treatment with excess acetic anhydride ($\ce{Ac_2O}$) and anhydrous sodium acetate ($\ce{NaOAc}$) at $373\text{ K}$ for a short duration, followed by rapid quenching, yielding major product P.\n\nCondition 2: Treatment with excess acetic anhydride ($\ce{Ac_2O}$) and a catalytic amount of anhydrous zinc chloride ($\ce{ZnCl_2}$) at $373\text{ K}$ for an extended period, yielding major product Q.\n\nConsidering the mutarotation kinetics and the geometry of the glycosidic linkage, identify the major products P and Q.

Consider the following carbohydrate derivatives: \begin{itemize} \item \textbf{X}: 1-O-acetyl-$\beta$-D-glucopyranose \item \textbf{Y}: Methyl $\beta$-D-glucopyranoside \item \textbf{Z}: 2-O-methyl-D-glucose \end{itemize} Each compound is independently heated with an excess of phenylhydrazine in an aqueous acetate buffer (pH $\approx 4.5$) at $100^\circ\text{C}$. Which of the following correctly describes the major outcome for each compound?

An aqueous solution containing 1.0 equivalent of (4R, 6S)-4,6-dihydroxyheptanoic acid and 1.0 equivalent of ethanol is treated with a catalytic amount of dilute \ce{H2SO4} at 298 K. The reaction mixture is allowed to reach equilibrium without the removal of water. Which of the following is the major organic product formed?

In the spontaneous formation of a dipeptide via Nucleophilic Acyl Substitution (NAS), the reactive intermediate requires the simultaneous presence of an unprotonated amine ($-\ce{NH2}$) as the nucleophile and a protonated carboxylic acid ($-\ce{COOH}$) as the electrophile. Consider an $\alpha$-amino acid in aqueous solution at 298 K with macroscopic acid dissociation constants $pK_{a1} = 2.0$ and $pK_{a2} = 9.0$. Let $f$ be the fraction of the amino acid molecules that exist in the highly reactive, completely neutral (non-zwitterionic) state at its isoelectric point. Given that the intrinsic $pK_a$ for the ionization of the $-\ce{COOH}$ group from this neutral species is 4.0, calculate the value of $-\log_{10}(f)$. (Assume that at the isoelectric point, the total concentration of the amino acid is overwhelmingly dominated by the zwitterionic form).

Potassium phthalimide is reacted with 2-bromo-2-methylpropane in $N,N$-dimethylformamide (DMF) at $350\text{ K}$. The reaction yields a gaseous hydrocarbon $\mathbf{X}$ and a nitrogen-containing compound $\mathbf{Y}$. Compound $\mathbf{Y}$ is isolated and subsequently heated with excess aqueous $\ce{NaOH}$, undergoing nucleophilic acyl substitution to yield a dicarboxylate salt and a gas $\mathbf{W}$. Which of the following correctly identifies $\mathbf{X}$ and $\mathbf{W}$?

Consider the modified Kiliani-Fischer synthesis of D-erythrose. D-Erythrose is treated with aqueous \ce{NaCN} at pH 9.5 to form a cyanohydrin mixture (\textbf{P}). \textbf{P} is catalytically hydrogenated (\ce{H2}, \ce{Pd-BaSO4}) to yield an $\alpha$-hydroxy imine intermediate (\textbf{Q}). Prior to the standard acidic hydrolysis, \textbf{Q} is inadvertently exposed to a mildly basic buffer (pH 8.5) for an extended period, leading to a loss of the initial kinetic diastereomeric ratio. It is subsequently hydrolyzed to the aldopentose mixture (\textbf{R}). Which of the following correctly identifies the key intermediate responsible for the epimerization at C-2 during the basic delay, and the final composition of \textbf{R}?

Consider the reaction of ethyl 2-oxocyclopentane-1-carboxylate with the following sequence of reagents:

1. $\ce{C6H5MgBr}$ (1 equivalent), dry THF, $298\text{ K}$
2. $\ce{CH2=CH-CH2Br}$ (1 equivalent), $298\text{ K}$
3. Mild $\ce{H3O+}$

Identify the major organic product formed.

An organic compound $P$, ethyl 2-oxocyclopentane-1-carboxylate, is treated with exactly one equivalent of methylmagnesium bromide ($\ce{CH3MgBr}$) in anhydrous THF at $298\ \text{K}$. A vigorous evolution of gas $X$ is observed. The resulting reaction mixture is subsequently treated with one equivalent of allyl bromide ($\ce{CH2=CH-CH2Br}$) to yield the major organic product $Y$. Identify the gas $X$ and the product $Y$.